C15H14BrN3O2S — CID 21233430
ethyl 1-(2,1,3-benzothiadiazol-5-ylmethyl)pyridin-1-ium-4-carboxylate bromide (PubChem CID 21233430) has the molecular formula C15H14BrN3O2S and a molecular weight of 380.27 g/mol. Its IUPAC name is ethyl 1-(2,1,3-benzothiadiazol-5-ylmethyl)pyridin-1-ium-4-carboxylate bromide.
| Compound Name | ethyl 1-(2,1,3-benzothiadiazol-5-ylmethyl)pyridin-1-ium-4-carboxylate bromide |
|---|---|
| PubChem CID | 21233430 |
| Molecular Formula | C15H14BrN3O2S |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | ethyl 1-(2,1,3-benzothiadiazol-5-ylmethyl)pyridin-1-ium-4-carboxylate bromide |
| SMILES | CCOC(=O)c1cc[n+](Cc2ccc3nsnc3c2)cc1.[Br-] |
| InChI | InChI=1S/C15H14N3O2S.BrH/c1-2-20-15(19)12-5-7-18(8-6-12)10-11-3-4-13-14(9-11)17-21-16-13;/h3-9H,2,10H2,1H3;1H/q+1;/p-1 |
| InChIKey | PDHLZAYKMZMGMI-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|