C12H19NS — CID 91161851
ethane;5-methyl-1,2-benzothiazole (PubChem CID 91161851) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is ethane;5-methyl-1,2-benzothiazole.
| Compound Name | ethane;5-methyl-1,2-benzothiazole |
|---|---|
| PubChem CID | 91161851 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethane;5-methyl-1,2-benzothiazole |
| SMILES | CC.CC.Cc1ccc2sncc2c1 |
| InChI | InChI=1S/C8H7NS.2C2H6/c1-6-2-3-8-7(4-6)5-9-10-8;2*1-2/h2-5H,1H3;2*1-2H3 |
| InChIKey | VWRNKKUUQQOVFE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |