C8H8NS2+ — CID 23515219
(5-methyl-1,3-benzothiazol-2-yl)sulfanium (PubChem CID 23515219) has the molecular formula C8H8NS2+ and a molecular weight of 182.29 g/mol. Its IUPAC name is (5-methyl-1,3-benzothiazol-2-yl)sulfanium.
| Compound Name | (5-methyl-1,3-benzothiazol-2-yl)sulfanium |
|---|---|
| PubChem CID | 23515219 |
| Molecular Formula | C8H8NS2+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | (5-methyl-1,3-benzothiazol-2-yl)sulfanium |
| SMILES | Cc1ccc2sc([SH2+])nc2c1 |
| InChI | InChI=1S/C8H7NS2/c1-5-2-3-7-6(4-5)9-8(10)11-7/h2-4H,1H3,(H,9,10)/p+1 |
| InChIKey | ILDUPWKUQLPLKK-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|