C27H26N2O3 — CID 18874648
3,6-bis(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine (PubChem CID 18874648) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3,6-bis(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine.
| Compound Name | 3,6-bis(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine |
|---|---|
| PubChem CID | 18874648 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3,6-bis(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine |
| SMILES | COc1cc(-c2cc(-c3ccc(C)cc3)nnc2-c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26N2O3/c1-17-6-10-19(11-7-17)23-16-22(26(29-28-23)20-12-8-18(2)9-13-20)21-14-24(30-3)27(32-5)25(15-21)31-4/h6-16H,1-5H3 |
| InChIKey | QWNOQCVIVDINLG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |