C20H20N2O4 — CID 172676310
3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine (PubChem CID 172676310) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine.
| Compound Name | 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine |
|---|---|
| PubChem CID | 172676310 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyridazine |
| SMILES | COc1ccc(-c2nnccc2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-23-15-7-5-13(6-8-15)19-16(9-10-21-22-19)14-11-17(24-2)20(26-4)18(12-14)25-3/h5-12H,1-4H3 |
| InChIKey | FLPCHOZHEYSTLP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |