C20H20O4S — CID 53388353
3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiophene (PubChem CID 53388353) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiophene.
| Compound Name | 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiophene |
|---|---|
| PubChem CID | 53388353 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiophene |
| SMILES | COc1ccc(-c2cscc2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H20O4S/c1-21-15-7-5-13(6-8-15)16-11-25-12-17(16)14-9-18(22-2)20(24-4)19(10-14)23-3/h5-12H,1-4H3 |
| InChIKey | JNKLVWHBRNGXQH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |