C8H5ClN2OS — CID 135666744
4-(4-chloro-1,2,5-thiadiazol-3-yl)phenol (PubChem CID 135666744) has the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. Its IUPAC name is 4-(4-chloro-1,2,5-thiadiazol-3-yl)phenol.
| Compound Name | 4-(4-chloro-1,2,5-thiadiazol-3-yl)phenol |
|---|---|
| PubChem CID | 135666744 |
| Molecular Formula | C8H5ClN2OS |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 4-(4-chloro-1,2,5-thiadiazol-3-yl)phenol |
| SMILES | Oc1ccc(-c2nsnc2Cl)cc1 |
| InChI | InChI=1S/C8H5ClN2OS/c9-8-7(10-13-11-8)5-1-3-6(12)4-2-5/h1-4,12H |
| InChIKey | OJFHIGWFBMAESL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |