C10H5ClN2O2S — CID 19800077
7-chloro-1,4-dihydro-[1]benzothiolo[2,3-b]pyrazine-2,3-dione (PubChem CID 19800077) has the molecular formula C10H5ClN2O2S and a molecular weight of 252.68 g/mol. Its IUPAC name is 7-chloro-1,4-dihydro-[1]benzothiolo[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-chloro-1,4-dihydro-[1]benzothiolo[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 19800077 |
| Molecular Formula | C10H5ClN2O2S |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 7-chloro-1,4-dihydro-[1]benzothiolo[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2sc3cc(Cl)ccc3c2[nH]c1=O |
| InChI | InChI=1S/C10H5ClN2O2S/c11-4-1-2-5-6(3-4)16-10-7(5)12-8(14)9(15)13-10/h1-3H,(H,12,14)(H,13,15) |
| InChIKey | QSXODYURTACOAJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|