C30H26NO4+ — CID 154596514
3,4,5-tris(4-methoxyphenyl)-2-phenyl-1,3-oxazol-3-ium (PubChem CID 154596514) has the molecular formula C30H26NO4+ and a molecular weight of 464.54 g/mol. Its IUPAC name is 3,4,5-tris(4-methoxyphenyl)-2-phenyl-1,3-oxazol-3-ium.
| Compound Name | 3,4,5-tris(4-methoxyphenyl)-2-phenyl-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 154596514 |
| Molecular Formula | C30H26NO4+ |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3,4,5-tris(4-methoxyphenyl)-2-phenyl-1,3-oxazol-3-ium |
| SMILES | COc1ccc(-c2oc(-c3ccccc3)[n+](-c3ccc(OC)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H26NO4/c1-32-25-15-9-21(10-16-25)28-29(22-11-17-26(33-2)18-12-22)35-30(23-7-5-4-6-8-23)31(28)24-13-19-27(34-3)20-14-24/h4-20H,1-3H3/q+1 |
| InChIKey | JDOGMFYVGXHPTH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 44.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|