C24H20NO+ — CID 12925199
1-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium (PubChem CID 12925199) has the molecular formula C24H20NO+ and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium.
| Compound Name | 1-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 12925199 |
| Molecular Formula | C24H20NO+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium |
| SMILES | COc1ccc(-[n+]2c(-c3ccccc3)cccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20NO/c1-26-22-17-15-21(16-18-22)25-23(19-9-4-2-5-10-19)13-8-14-24(25)20-11-6-3-7-12-20/h2-18H,1H3/q+1 |
| InChIKey | NBQJBPWNJYKGKQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|