C18H13F3NO4+ — CID 10882993
2,2,2-trifluoro-1-[5-hydroxy-2-(4-methoxyphenyl)-3-phenyl-1,3-oxazol-3-ium-4-yl]ethanone (PubChem CID 10882993) has the molecular formula C18H13F3NO4+ and a molecular weight of 364.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[5-hydroxy-2-(4-methoxyphenyl)-3-phenyl-1,3-oxazol-3-ium-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[5-hydroxy-2-(4-methoxyphenyl)-3-phenyl-1,3-oxazol-3-ium-4-yl]ethanone |
|---|---|
| PubChem CID | 10882993 |
| Molecular Formula | C18H13F3NO4+ |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2,2,2-trifluoro-1-[5-hydroxy-2-(4-methoxyphenyl)-3-phenyl-1,3-oxazol-3-ium-4-yl]ethanone |
| SMILES | COc1ccc(-c2oc(O)c(C(=O)C(F)(F)F)[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H12F3NO4/c1-25-13-9-7-11(8-10-13)16-22(12-5-3-2-4-6-12)14(17(24)26-16)15(23)18(19,20)21/h2-10H,1H3/p+1 |
| InChIKey | SFNOHXLBGGMDKM-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|