C23H18O2 — CID 2733040
5-(4-methoxyphenyl)-2,3-diphenylfuran (PubChem CID 2733040) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3-diphenylfuran.
| Compound Name | 5-(4-methoxyphenyl)-2,3-diphenylfuran |
|---|---|
| PubChem CID | 2733040 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3-diphenylfuran |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H18O2/c1-24-20-14-12-18(13-15-20)22-16-21(17-8-4-2-5-9-17)23(25-22)19-10-6-3-7-11-19/h2-16H,1H3 |
| InChIKey | GKDGDMFKEAMOEI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |