C54H58O8Si2 — CID 101413684
triethoxy-[(E)-2-[4-[4-phenyl-5-[4-[3-phenyl-5-[4-[(E)-2-triethoxysilylethenyl]phenyl]furan-2-yl]phenyl]furan-2-yl]phenyl]ethenyl]silane (PubChem CID 101413684) has the molecular formula C54H58O8Si2 and a molecular weight of 891.22 g/mol. Its IUPAC name is triethoxy-[(E)-2-[4-[4-phenyl-5-[4-[3-phenyl-5-[4-[(E)-2-triethoxysilylethenyl]phenyl]furan-2-yl]phenyl]furan-2-yl]phenyl]ethenyl]silane.
| Compound Name | triethoxy-[(E)-2-[4-[4-phenyl-5-[4-[3-phenyl-5-[4-[(E)-2-triethoxysilylethenyl]phenyl]furan-2-yl]phenyl]furan-2-yl]phenyl]ethenyl]silane |
|---|---|
| PubChem CID | 101413684 |
| Molecular Formula | C54H58O8Si2 |
| Molecular Weight | 891.22 g/mol |
| Exact Mass | 890.37 |
| IUPAC Name | triethoxy-[(E)-2-[4-[4-phenyl-5-[4-[3-phenyl-5-[4-[(E)-2-triethoxysilylethenyl]phenyl]furan-2-yl]phenyl]furan-2-yl]phenyl]ethenyl]silane |
| SMILES | CCO[Si](/C=C/c1ccc(-c2cc(-c3ccccc3)c(-c3ccc(-c4oc(-c5ccc(/C=C/[Si](OCC)(OCC)OCC)cc5)cc4-c4ccccc4)cc3)o2)cc1)(OCC)OCC |
| InChI | InChI=1S/C54H58O8Si2/c1-7-55-63(56-8-2,57-9-3)37-35-41-23-27-45(28-24-41)51-39-49(43-19-15-13-16-20-43)53(61-51)47-31-33-48(34-32-47)54-50(44-21-17-14-18-22-44)40-52(62-54)46-29-25-42(26-30-46)36-38-64(58-10-4,59-11-5)60-12-6/h13-40H,7-12H2,1-6H3/b37-35+,38-36+ |
| InChIKey | WSRHLTWMIVPZQZ-ATXIYDNESA-N |
| XLogP | 14.08 |
| TPSA | 81.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.22 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|