C16H11ClO — CID 10824877
2-chloro-3,5-diphenylfuran (PubChem CID 10824877) has the molecular formula C16H11ClO and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-chloro-3,5-diphenylfuran.
| Compound Name | 2-chloro-3,5-diphenylfuran |
|---|---|
| PubChem CID | 10824877 |
| Molecular Formula | C16H11ClO |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-chloro-3,5-diphenylfuran |
| SMILES | Clc1oc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C16H11ClO/c17-16-14(12-7-3-1-4-8-12)11-15(18-16)13-9-5-2-6-10-13/h1-11H |
| InChIKey | ZKQZFEFVCMPPCT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |