C29H20OS — CID 71379689
3,4-diphenyl-6-(4-phenylphenyl)pyran-2-thione (PubChem CID 71379689) has the molecular formula C29H20OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 3,4-diphenyl-6-(4-phenylphenyl)pyran-2-thione.
| Compound Name | 3,4-diphenyl-6-(4-phenylphenyl)pyran-2-thione |
|---|---|
| PubChem CID | 71379689 |
| Molecular Formula | C29H20OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3,4-diphenyl-6-(4-phenylphenyl)pyran-2-thione |
| SMILES | S=c1oc(-c2ccc(-c3ccccc3)cc2)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C29H20OS/c31-29-28(25-14-8-3-9-15-25)26(23-12-6-2-7-13-23)20-27(30-29)24-18-16-22(17-19-24)21-10-4-1-5-11-21/h1-20H |
| InChIKey | TYLFXFKIXFMXHH-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|