C24H18O2S — CID 11428674
6-(4-methylsulfanylphenyl)-3,4-diphenylpyran-2-one (PubChem CID 11428674) has the molecular formula C24H18O2S and a molecular weight of 370.47 g/mol. Its IUPAC name is 6-(4-methylsulfanylphenyl)-3,4-diphenylpyran-2-one.
| Compound Name | 6-(4-methylsulfanylphenyl)-3,4-diphenylpyran-2-one |
|---|---|
| PubChem CID | 11428674 |
| Molecular Formula | C24H18O2S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 6-(4-methylsulfanylphenyl)-3,4-diphenylpyran-2-one |
| SMILES | CSc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)c(=O)o2)cc1 |
| InChI | InChI=1S/C24H18O2S/c1-27-20-14-12-18(13-15-20)22-16-21(17-8-4-2-5-9-17)23(24(25)26-22)19-10-6-3-7-11-19/h2-16H,1H3 |
| InChIKey | KBQMJDYBAGVYCD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |