C24H22N3O4S+ — CID 4560457
2-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]-1-(4-nitrophenyl)ethanol (PubChem CID 4560457) has the molecular formula C24H22N3O4S+ and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]-1-(4-nitrophenyl)ethanol.
| Compound Name | 2-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]-1-(4-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 4560457 |
| Molecular Formula | C24H22N3O4S+ |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]-1-(4-nitrophenyl)ethanol |
| SMILES | COc1ccc(-c2csc(Nc3ccccc3)[n+]2CC(O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-31-21-13-9-17(10-14-21)22-16-32-24(25-19-5-3-2-4-6-19)26(22)15-23(28)18-7-11-20(12-8-18)27(29)30/h2-14,16,23,28H,15H2,1H3/p+1 |
| InChIKey | QKZRRGSYSBVQHQ-UHFFFAOYSA-O |
| XLogP | 5.10 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|