C23H24N2O5 — CID 132591721
1,3-bis(4-methoxyphenyl)-3-(4-nitroanilino)propan-1-ol (PubChem CID 132591721) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-3-(4-nitroanilino)propan-1-ol.
| Compound Name | 1,3-bis(4-methoxyphenyl)-3-(4-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 132591721 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-3-(4-nitroanilino)propan-1-ol |
| SMILES | COc1ccc(C(O)CC(Nc2ccc([N+](=O)[O-])cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O5/c1-29-20-11-3-16(4-12-20)22(24-18-7-9-19(10-8-18)25(27)28)15-23(26)17-5-13-21(30-2)14-6-17/h3-14,22-24,26H,15H2,1-2H3 |
| InChIKey | WDWLSEXFZWSZHF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|