C17H18N2O5 — CID 11858783
(3S,4R)-3-hydroxy-4-(4-methoxyanilino)-4-(4-nitrophenyl)butan-2-one (PubChem CID 11858783) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4-(4-methoxyanilino)-4-(4-nitrophenyl)butan-2-one.
| Compound Name | (3S,4R)-3-hydroxy-4-(4-methoxyanilino)-4-(4-nitrophenyl)butan-2-one |
|---|---|
| PubChem CID | 11858783 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3S,4R)-3-hydroxy-4-(4-methoxyanilino)-4-(4-nitrophenyl)butan-2-one |
| SMILES | COc1ccc(N[C@H](c2ccc([N+](=O)[O-])cc2)[C@H](O)C(C)=O)cc1 |
| InChI | InChI=1S/C17H18N2O5/c1-11(20)17(21)16(12-3-7-14(8-4-12)19(22)23)18-13-5-9-15(24-2)10-6-13/h3-10,16-18,21H,1-2H3/t16-,17-/m1/s1 |
| InChIKey | MVQRRRLRTOWWPU-IAGOWNOFSA-N |
| XLogP | 2.71 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|