C14H16N2O4S — CID 110911125
1-(4-methoxyphenyl)-2-[(5-nitrothiophen-3-yl)methylamino]ethanol (PubChem CID 110911125) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[(5-nitrothiophen-3-yl)methylamino]ethanol.
| Compound Name | 1-(4-methoxyphenyl)-2-[(5-nitrothiophen-3-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 110911125 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[(5-nitrothiophen-3-yl)methylamino]ethanol |
| SMILES | COc1ccc(C(O)CNCc2csc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-20-12-4-2-11(3-5-12)13(17)8-15-7-10-6-14(16(18)19)21-9-10/h2-6,9,13,15,17H,7-8H2,1H3 |
| InChIKey | AWQPXMWVMLDNOK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|