C14H15BrN2O4S — CID 119123535
1-(2-bromo-4,5-dimethoxyphenyl)-N-[(5-nitrothiophen-3-yl)methyl]methanamine (PubChem CID 119123535) has the molecular formula C14H15BrN2O4S and a molecular weight of 387.26 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-N-[(5-nitrothiophen-3-yl)methyl]methanamine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-[(5-nitrothiophen-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 119123535 |
| Molecular Formula | C14H15BrN2O4S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-[(5-nitrothiophen-3-yl)methyl]methanamine |
| SMILES | COc1cc(Br)c(CNCc2csc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C14H15BrN2O4S/c1-20-12-4-10(11(15)5-13(12)21-2)7-16-6-9-3-14(17(18)19)22-8-9/h3-5,8,16H,6-7H2,1-2H3 |
| InChIKey | LVADGPOKSWDBDA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|