C10H17N3O2S — CID 60810721
N',N'-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]propane-1,3-diamine (PubChem CID 60810721) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60810721 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N',N'-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNCc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H17N3O2S/c1-12(2)5-3-4-11-7-9-6-10(13(14)15)16-8-9/h6,8,11H,3-5,7H2,1-2H3 |
| InChIKey | AGRQXKAZWBTIFW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|