C17H19BrN2O4 — CID 119123536
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methyl-3-nitrophenyl)methanamine (PubChem CID 119123536) has the molecular formula C17H19BrN2O4 and a molecular weight of 395.25 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methyl-3-nitrophenyl)methanamine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methyl-3-nitrophenyl)methanamine |
|---|---|
| PubChem CID | 119123536 |
| Molecular Formula | C17H19BrN2O4 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methyl-3-nitrophenyl)methanamine |
| SMILES | COc1cc(Br)c(CNCc2ccc(C)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C17H19BrN2O4/c1-11-4-5-12(6-15(11)20(21)22)9-19-10-13-7-16(23-2)17(24-3)8-14(13)18/h4-8,19H,9-10H2,1-3H3 |
| InChIKey | MQLNDXMDGQHOPB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|