C18H19BrN2O5 — CID 1406314
3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methyl-3-nitrophenyl)propanamide (PubChem CID 1406314) has the molecular formula C18H19BrN2O5 and a molecular weight of 423.26 g/mol. Its IUPAC name is 3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methyl-3-nitrophenyl)propanamide.
| Compound Name | 3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 1406314 |
| Molecular Formula | C18H19BrN2O5 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-methyl-3-nitrophenyl)propanamide |
| SMILES | COc1cc(Br)c(CCC(=O)Nc2ccc(C)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C18H19BrN2O5/c1-11-4-6-13(9-15(11)21(23)24)20-18(22)7-5-12-8-16(25-2)17(26-3)10-14(12)19/h4,6,8-10H,5,7H2,1-3H3,(H,20,22) |
| InChIKey | NWZOIBWHQZCZRM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|