C20H23BrN2O4 — CID 19206305
4-(2-bromo-4-propan-2-ylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide (PubChem CID 19206305) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 4-(2-bromo-4-propan-2-ylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 19206305 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCOc2ccc(C(C)C)cc2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23BrN2O4/c1-13(2)15-7-9-19(17(21)11-15)27-10-4-5-20(24)22-16-8-6-14(3)18(12-16)23(25)26/h6-9,11-13H,4-5,10H2,1-3H3,(H,22,24) |
| InChIKey | IKKSYPHNIATMST-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|