C23H31BrN2O2 — CID 19206319
4-(2-bromo-4-propan-2-ylphenoxy)-N-[4-(diethylamino)phenyl]butanamide (PubChem CID 19206319) has the molecular formula C23H31BrN2O2 and a molecular weight of 447.42 g/mol. Its IUPAC name is 4-(2-bromo-4-propan-2-ylphenoxy)-N-[4-(diethylamino)phenyl]butanamide.
| Compound Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-[4-(diethylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 19206319 |
| Molecular Formula | C23H31BrN2O2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-[4-(diethylamino)phenyl]butanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCCOc2ccc(C(C)C)cc2Br)cc1 |
| InChI | InChI=1S/C23H31BrN2O2/c1-5-26(6-2)20-12-10-19(11-13-20)25-23(27)8-7-15-28-22-14-9-18(17(3)4)16-21(22)24/h9-14,16-17H,5-8,15H2,1-4H3,(H,25,27) |
| InChIKey | CPLBIKBCAMUIMY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|