C21H27BrN2O2 — CID 19202635
4-(2-bromo-4-methylphenoxy)-N-[4-(diethylamino)phenyl]butanamide (PubChem CID 19202635) has the molecular formula C21H27BrN2O2 and a molecular weight of 419.36 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenoxy)-N-[4-(diethylamino)phenyl]butanamide.
| Compound Name | 4-(2-bromo-4-methylphenoxy)-N-[4-(diethylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 19202635 |
| Molecular Formula | C21H27BrN2O2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-(2-bromo-4-methylphenoxy)-N-[4-(diethylamino)phenyl]butanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCCOc2ccc(C)cc2Br)cc1 |
| InChI | InChI=1S/C21H27BrN2O2/c1-4-24(5-2)18-11-9-17(10-12-18)23-21(25)7-6-14-26-20-13-8-16(3)15-19(20)22/h8-13,15H,4-7,14H2,1-3H3,(H,23,25) |
| InChIKey | XWORJCZHQXXARB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|