C22H29ClN2O2 — CID 19191158
4-(4-chloro-3,5-dimethylphenoxy)-N-[4-(diethylamino)phenyl]butanamide (PubChem CID 19191158) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-N-[4-(diethylamino)phenyl]butanamide.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-[4-(diethylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 19191158 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-[4-(diethylamino)phenyl]butanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCCOc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C22H29ClN2O2/c1-5-25(6-2)19-11-9-18(10-12-19)24-21(26)8-7-13-27-20-14-16(3)22(23)17(4)15-20/h9-12,14-15H,5-8,13H2,1-4H3,(H,24,26) |
| InChIKey | PVPSDXKCERNMRG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|