C20H24ClNO4 — CID 19191082
4-(4-chloro-3,5-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide (PubChem CID 19191082) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 19191082 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCOc2cc(C)c(Cl)c(C)c2)cc1OC |
| InChI | InChI=1S/C20H24ClNO4/c1-13-10-16(11-14(2)20(13)21)26-9-5-6-19(23)22-15-7-8-17(24-3)18(12-15)25-4/h7-8,10-12H,5-6,9H2,1-4H3,(H,22,23) |
| InChIKey | DDIGMNQHLIYTKY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|