C19H21BrClNO2 — CID 19206243
4-(2-bromo-4-propan-2-ylphenoxy)-N-(3-chlorophenyl)butanamide (PubChem CID 19206243) has the molecular formula C19H21BrClNO2 and a molecular weight of 410.74 g/mol. Its IUPAC name is 4-(2-bromo-4-propan-2-ylphenoxy)-N-(3-chlorophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(3-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 19206243 |
| Molecular Formula | C19H21BrClNO2 |
| Molecular Weight | 410.74 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(3-chlorophenyl)butanamide |
| SMILES | CC(C)c1ccc(OCCCC(=O)Nc2cccc(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C19H21BrClNO2/c1-13(2)14-8-9-18(17(20)11-14)24-10-4-7-19(23)22-16-6-3-5-15(21)12-16/h3,5-6,8-9,11-13H,4,7,10H2,1-2H3,(H,22,23) |
| InChIKey | JSHGRHCLJJLNAN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|