C20H23BrClNO2 — CID 19206295
4-(2-bromo-4-propan-2-ylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide (PubChem CID 19206295) has the molecular formula C20H23BrClNO2 and a molecular weight of 424.77 g/mol. Its IUPAC name is 4-(2-bromo-4-propan-2-ylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 19206295 |
| Molecular Formula | C20H23BrClNO2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(5-chloro-2-methylphenyl)butanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CCCOc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C20H23BrClNO2/c1-13(2)15-7-9-19(17(21)11-15)25-10-4-5-20(24)23-18-12-16(22)8-6-14(18)3/h6-9,11-13H,4-5,10H2,1-3H3,(H,23,24) |
| InChIKey | OZUYBCZXDBOXKW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|