C22H27BrN2O3 — CID 1406329
3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 1406329) has the molecular formula C22H27BrN2O3 and a molecular weight of 447.37 g/mol. Its IUPAC name is 3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | 3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 1406329 |
| Molecular Formula | C22H27BrN2O3 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-(2-bromo-4,5-dimethoxyphenyl)-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | COc1cc(Br)c(CCC(=O)Nc2ccc(N3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C22H27BrN2O3/c1-27-20-14-16(19(23)15-21(20)28-2)6-11-22(26)24-17-7-9-18(10-8-17)25-12-4-3-5-13-25/h7-10,14-15H,3-6,11-13H2,1-2H3,(H,24,26) |
| InChIKey | SFAKNFHPZUXPIP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|