C14H14F2N2O4S — CID 111104806
1-(3,4-difluorophenoxy)-3-[(5-nitrothiophen-3-yl)methylamino]propan-2-ol (PubChem CID 111104806) has the molecular formula C14H14F2N2O4S and a molecular weight of 344.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenoxy)-3-[(5-nitrothiophen-3-yl)methylamino]propan-2-ol.
| Compound Name | 1-(3,4-difluorophenoxy)-3-[(5-nitrothiophen-3-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 111104806 |
| Molecular Formula | C14H14F2N2O4S |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-(3,4-difluorophenoxy)-3-[(5-nitrothiophen-3-yl)methylamino]propan-2-ol |
| SMILES | O=[N+]([O-])c1cc(CNCC(O)COc2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C14H14F2N2O4S/c15-12-2-1-11(4-13(12)16)22-7-10(19)6-17-5-9-3-14(18(20)21)23-8-9/h1-4,8,10,17,19H,5-7H2 |
| InChIKey | PPVKBVNKTVOUGA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|