C20H23BrN2S — CID 2833344
N-tert-butyl-3-(4-methylphenyl)-4-phenyl-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 2833344) has the molecular formula C20H23BrN2S and a molecular weight of 403.39 g/mol. Its IUPAC name is N-tert-butyl-3-(4-methylphenyl)-4-phenyl-1,3-thiazol-3-ium-2-amine bromide.
| Compound Name | N-tert-butyl-3-(4-methylphenyl)-4-phenyl-1,3-thiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 2833344 |
| Molecular Formula | C20H23BrN2S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-tert-butyl-3-(4-methylphenyl)-4-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | Cc1ccc(-[n+]2c(-c3ccccc3)csc2NC(C)(C)C)cc1.[Br-] |
| InChI | InChI=1S/C20H22N2S.BrH/c1-15-10-12-17(13-11-15)22-18(16-8-6-5-7-9-16)14-23-19(22)21-20(2,3)4;/h5-14H,1-4H3;1H |
| InChIKey | NKSYFIREWCTJTM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|