C22H20BrN3S — CID 146171512
2-N-benzyl-3-N,4-diphenyl-1,3-thiazol-3-ium-2,3-diamine bromide (PubChem CID 146171512) has the molecular formula C22H20BrN3S and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-N-benzyl-3-N,4-diphenyl-1,3-thiazol-3-ium-2,3-diamine bromide.
| Compound Name | 2-N-benzyl-3-N,4-diphenyl-1,3-thiazol-3-ium-2,3-diamine bromide |
|---|---|
| PubChem CID | 146171512 |
| Molecular Formula | C22H20BrN3S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-N-benzyl-3-N,4-diphenyl-1,3-thiazol-3-ium-2,3-diamine bromide |
| SMILES | [Br-].c1ccc(CNc2scc(-c3ccccc3)[n+]2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N3S.BrH/c1-4-10-18(11-5-1)16-23-22-25(24-20-14-8-3-9-15-20)21(17-26-22)19-12-6-2-7-13-19;/h1-15,17,24H,16H2;1H |
| InChIKey | NKCZBOVGWBYTJM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|