C11H12N2S — CID 96590698
2-N-benzylthiophene-2,4-diamine (PubChem CID 96590698) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 2-N-benzylthiophene-2,4-diamine.
| Compound Name | 2-N-benzylthiophene-2,4-diamine |
|---|---|
| PubChem CID | 96590698 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-N-benzylthiophene-2,4-diamine |
| SMILES | Nc1csc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C11H12N2S/c12-10-6-11(14-8-10)13-7-9-4-2-1-3-5-9/h1-6,8,13H,7,12H2 |
| InChIKey | DBETUOBTDXUURR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |