C17H16N2S — CID 175800702
4-N-benzyl-2-thiophen-2-ylbenzene-1,4-diamine (PubChem CID 175800702) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-N-benzyl-2-thiophen-2-ylbenzene-1,4-diamine.
| Compound Name | 4-N-benzyl-2-thiophen-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 175800702 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-N-benzyl-2-thiophen-2-ylbenzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2ccccc2)cc1-c1cccs1 |
| InChI | InChI=1S/C17H16N2S/c18-16-9-8-14(11-15(16)17-7-4-10-20-17)19-12-13-5-2-1-3-6-13/h1-11,19H,12,18H2 |
| InChIKey | CGUMJBXZUNGAAW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|