C26H26N2OS — CID 173278572
N-[[7-(benzylamino)-3-thiophen-2-ylnaphthalen-1-yl]methyl]butanamide (PubChem CID 173278572) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[[7-(benzylamino)-3-thiophen-2-ylnaphthalen-1-yl]methyl]butanamide.
| Compound Name | N-[[7-(benzylamino)-3-thiophen-2-ylnaphthalen-1-yl]methyl]butanamide |
|---|---|
| PubChem CID | 173278572 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[[7-(benzylamino)-3-thiophen-2-ylnaphthalen-1-yl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1cc(-c2cccs2)cc2ccc(NCc3ccccc3)cc12 |
| InChI | InChI=1S/C26H26N2OS/c1-2-7-26(29)28-18-22-15-21(25-10-6-13-30-25)14-20-11-12-23(16-24(20)22)27-17-19-8-4-3-5-9-19/h3-6,8-16,27H,2,7,17-18H2,1H3,(H,28,29) |
| InChIKey | FYXYMTOWRULULR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |