C10H10N2S — CID 95913796
N-benzyl-1,2-thiazol-4-amine (PubChem CID 95913796) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is N-benzyl-1,2-thiazol-4-amine.
| Compound Name | N-benzyl-1,2-thiazol-4-amine |
|---|---|
| PubChem CID | 95913796 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | N-benzyl-1,2-thiazol-4-amine |
| SMILES | c1ccc(CNc2cnsc2)cc1 |
| InChI | InChI=1S/C10H10N2S/c1-2-4-9(5-3-1)6-11-10-7-12-13-8-10/h1-5,7-8,11H,6H2 |
| InChIKey | QHCXVHHSOSZNON-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |