C13H11Br2N — CID 10640949
N-benzyl-3,5-dibromoaniline (PubChem CID 10640949) has the molecular formula C13H11Br2N and a molecular weight of 341.05 g/mol. Its IUPAC name is N-benzyl-3,5-dibromoaniline.
| Compound Name | N-benzyl-3,5-dibromoaniline |
|---|---|
| PubChem CID | 10640949 |
| Molecular Formula | C13H11Br2N |
| Molecular Weight | 341.05 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | N-benzyl-3,5-dibromoaniline |
| SMILES | Brc1cc(Br)cc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C13H11Br2N/c14-11-6-12(15)8-13(7-11)16-9-10-4-2-1-3-5-10/h1-8,16H,9H2 |
| InChIKey | PGEQVBGSPPXHRX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.05 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |