About N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine
N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine (PubChem CID 158372976) has the molecular formula C28H31BrN2
and a molecular weight of 475.47 g/mol. Its IUPAC name is N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine.
Molecular Properties
| Compound Name | N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine |
| PubChem CID | 158372976 |
| Molecular Formula | C28H31BrN2 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine |
| SMILES | Cc1ccc(Br)cc1.Cc1ccc(NCc2ccccc2)cc1.NCc1ccccc1 |
| InChI | InChI=1S/C14H15N.C7H7Br.C7H9N/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13;1-6-2-4-7(8)5-3-6;8-6-7-4-2-1-3-5-7/h2-10,15H,11H2,1H3;2-5H,1H3;1-5H,6,8H2 |
| InChIKey | GUVQHHJFOGYPQV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine?
The IUPAC name of N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine (CID 158372976) is N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine.
What is the SMILES notation for N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine?
The canonical SMILES for N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine is Cc1ccc(Br)cc1.Cc1ccc(NCc2ccccc2)cc1.NCc1ccccc1.
What is the InChIKey of N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine?
The InChIKey is GUVQHHJFOGYPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.C7H7Br.C7H9N/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13;1-6-2-4-7(8)5-3-6;8-6-7-4-2-1-3-5-7/h2-10,15H,11H2,1H3;2-5H,1H3;1-5H,6,8H2.
What are the key properties of N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine?
N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine has a molecular weight of 475.47 g/mol, XLogP of 7.51, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-methylaniline;1-bromo-4-methylbenzene;phenylmethanamine is sourced from PubChem (CID 158372976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).