C18H18N3S+ — CID 146171452
3-N,4-diphenyl-2-N-prop-2-enyl-1,3-thiazol-3-ium-2,3-diamine (PubChem CID 146171452) has the molecular formula C18H18N3S+ and a molecular weight of 308.43 g/mol. Its IUPAC name is 3-N,4-diphenyl-2-N-prop-2-enyl-1,3-thiazol-3-ium-2,3-diamine.
| Compound Name | 3-N,4-diphenyl-2-N-prop-2-enyl-1,3-thiazol-3-ium-2,3-diamine |
|---|---|
| PubChem CID | 146171452 |
| Molecular Formula | C18H18N3S+ |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-N,4-diphenyl-2-N-prop-2-enyl-1,3-thiazol-3-ium-2,3-diamine |
| SMILES | C=CCNc1scc(-c2ccccc2)[n+]1Nc1ccccc1 |
| InChI | InChI=1S/C18H17N3S/c1-2-13-19-18-21(20-16-11-7-4-8-12-16)17(14-22-18)15-9-5-3-6-10-15/h2-12,14,20H,1,13H2/p+1 |
| InChIKey | FIKGVMTZEMMVOU-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 27.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|