C52H62NO+ — CID 143769684
ethane;1-[4-methoxy-3-[(2E,4Z)-7-methylocta-2,4,6-trien-3-yl]-5-phenylphenyl]-2-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]-4,6-diphenylpyridin-1-ium (PubChem CID 143769684) has the molecular formula C52H62NO+ and a molecular weight of 717.07 g/mol. Its IUPAC name is ethane;1-[4-methoxy-3-[(2E,4Z)-7-methylocta-2,4,6-trien-3-yl]-5-phenylphenyl]-2-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]-4,6-diphenylpyridin-1-ium.
| Compound Name | ethane;1-[4-methoxy-3-[(2E,4Z)-7-methylocta-2,4,6-trien-3-yl]-5-phenylphenyl]-2-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]-4,6-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 143769684 |
| Molecular Formula | C52H62NO+ |
| Molecular Weight | 717.07 g/mol |
| Exact Mass | 716.48 |
| IUPAC Name | ethane;1-[4-methoxy-3-[(2E,4Z)-7-methylocta-2,4,6-trien-3-yl]-5-phenylphenyl]-2-[(2E,4Z)-7-methylocta-2,4-dien-3-yl]-4,6-diphenylpyridin-1-ium |
| SMILES | C/C=C(\C=C/C=C(C)C)c1cc(-[n+]2c(C(/C=C\CC(C)C)=C/C)cc(-c3ccccc3)cc2-c2ccccc2)cc(-c2ccccc2)c1OC.CC.CC |
| InChI | InChI=1S/C48H50NO.2C2H6/c1-8-37(29-19-21-35(3)4)44-33-43(34-45(48(44)50-7)40-25-15-11-16-26-40)49-46(38(9-2)30-20-22-36(5)6)31-42(39-23-13-10-14-24-39)32-47(49)41-27-17-12-18-28-41;2*1-2/h8-21,23-34,36H,22H2,1-7H3;2*1-2H3/q+1;;/b29-19-,30-20-,37-8+,38-9+;; |
| InChIKey | OKZFIWGYPXFLPO-XRASCCAXSA-N |
| XLogP | 14.96 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.07 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|