About methyl 2-methoxy-3,5-diphenylbenzoate
methyl 2-methoxy-3,5-diphenylbenzoate (PubChem CID 142693331) has the molecular formula C21H18O3
and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 2-methoxy-3,5-diphenylbenzoate.
Molecular Properties
| Compound Name | methyl 2-methoxy-3,5-diphenylbenzoate |
| PubChem CID | 142693331 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | methyl 2-methoxy-3,5-diphenylbenzoate |
| SMILES | COC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)c1OC |
| InChI | InChI=1S/C21H18O3/c1-23-20-18(16-11-7-4-8-12-16)13-17(14-19(20)21(22)24-2)15-9-5-3-6-10-15/h3-14H,1-2H3 |
| InChIKey | ICRYWLSFKCRVDE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-methoxy-3,5-diphenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methoxy-3,5-diphenylbenzoate?
The IUPAC name of methyl 2-methoxy-3,5-diphenylbenzoate (CID 142693331) is methyl 2-methoxy-3,5-diphenylbenzoate.
What is the SMILES notation for methyl 2-methoxy-3,5-diphenylbenzoate?
The canonical SMILES for methyl 2-methoxy-3,5-diphenylbenzoate is COC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)c1OC.
What is the InChIKey of methyl 2-methoxy-3,5-diphenylbenzoate?
The InChIKey is ICRYWLSFKCRVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O3/c1-23-20-18(16-11-7-4-8-12-16)13-17(14-19(20)21(22)24-2)15-9-5-3-6-10-15/h3-14H,1-2H3.
What are the key properties of methyl 2-methoxy-3,5-diphenylbenzoate?
methyl 2-methoxy-3,5-diphenylbenzoate has a molecular weight of 318.37 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methoxy-3,5-diphenylbenzoate is sourced from PubChem (CID 142693331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).