C27H21BF4N2O2S — CID 13114953
ethyl 1-(1,3-benzothiazol-2-yl)-4,6-diphenylpyridin-1-ium-2-carboxylate tetrafluoroborate (PubChem CID 13114953) has the molecular formula C27H21BF4N2O2S and a molecular weight of 524.35 g/mol. Its IUPAC name is ethyl 1-(1,3-benzothiazol-2-yl)-4,6-diphenylpyridin-1-ium-2-carboxylate tetrafluoroborate.
| Compound Name | ethyl 1-(1,3-benzothiazol-2-yl)-4,6-diphenylpyridin-1-ium-2-carboxylate tetrafluoroborate |
|---|---|
| PubChem CID | 13114953 |
| Molecular Formula | C27H21BF4N2O2S |
| Molecular Weight | 524.35 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | ethyl 1-(1,3-benzothiazol-2-yl)-4,6-diphenylpyridin-1-ium-2-carboxylate tetrafluoroborate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1nc2ccccc2s1.F[B-](F)(F)F |
| InChI | InChI=1S/C27H21N2O2S.BF4/c1-2-31-26(30)24-18-21(19-11-5-3-6-12-19)17-23(20-13-7-4-8-14-20)29(24)27-28-22-15-9-10-16-25(22)32-27;2-1(3,4)5/h3-18H,2H2,1H3;/q+1;-1 |
| InChIKey | JBWPFDCXAUGASP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.35 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|