C30H26N+ — CID 102393069
2-azulen-1-yl-4,6-diphenyl-1-propan-2-ylpyridin-1-ium (PubChem CID 102393069) has the molecular formula C30H26N+ and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-azulen-1-yl-4,6-diphenyl-1-propan-2-ylpyridin-1-ium.
| Compound Name | 2-azulen-1-yl-4,6-diphenyl-1-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 102393069 |
| Molecular Formula | C30H26N+ |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-azulen-1-yl-4,6-diphenyl-1-propan-2-ylpyridin-1-ium |
| SMILES | CC(C)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccc2cccccc1-2 |
| InChI | InChI=1S/C30H26N/c1-22(2)31-29(25-15-9-4-10-16-25)20-26(23-12-6-3-7-13-23)21-30(31)28-19-18-24-14-8-5-11-17-27(24)28/h3-22H,1-2H3/q+1 |
| InChIKey | DYWUTSABIJMWKO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|