C26H24NO2+ — CID 68988807
1-(2,4,6-triphenylpyridin-1-ium-1-yl)propane-1,3-diol (PubChem CID 68988807) has the molecular formula C26H24NO2+ and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-(2,4,6-triphenylpyridin-1-ium-1-yl)propane-1,3-diol.
| Compound Name | 1-(2,4,6-triphenylpyridin-1-ium-1-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 68988807 |
| Molecular Formula | C26H24NO2+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-(2,4,6-triphenylpyridin-1-ium-1-yl)propane-1,3-diol |
| SMILES | OCCC(O)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C26H24NO2/c28-17-16-26(29)27-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(27)22-14-8-3-9-15-22/h1-15,18-19,26,28-29H,16-17H2/q+1 |
| InChIKey | AEJPQJPPXUJKJI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|