C27H22BF4NO2 — CID 13400542
4-methyl-3,6,8-triphenyl-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one tetrafluoroborate (PubChem CID 13400542) has the molecular formula C27H22BF4NO2 and a molecular weight of 479.28 g/mol. Its IUPAC name is 4-methyl-3,6,8-triphenyl-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one tetrafluoroborate.
| Compound Name | 4-methyl-3,6,8-triphenyl-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one tetrafluoroborate |
|---|---|
| PubChem CID | 13400542 |
| Molecular Formula | C27H22BF4NO2 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-methyl-3,6,8-triphenyl-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one tetrafluoroborate |
| SMILES | CC1C(c2ccccc2)OC(=O)c2cc(-c3ccccc3)cc(-c3ccccc3)[n+]21.F[B-](F)(F)F |
| InChI | InChI=1S/C27H22NO2.BF4/c1-19-26(22-15-9-4-10-16-22)30-27(29)25-18-23(20-11-5-2-6-12-20)17-24(28(19)25)21-13-7-3-8-14-21;2-1(3,4)5/h2-19,26H,1H3;/q+1;-1 |
| InChIKey | ILBMFAOCTILDQV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|