C13H13ClF6 — CID 103310672
1-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-propan-2-ylbenzene (PubChem CID 103310672) has the molecular formula C13H13ClF6 and a molecular weight of 318.69 g/mol. Its IUPAC name is 1-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-propan-2-ylbenzene.
| Compound Name | 1-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 103310672 |
| Molecular Formula | C13H13ClF6 |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(C(Cl)C(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13ClF6/c1-7(2)8-3-5-9(6-4-8)10(14)11(12(15,16)17)13(18,19)20/h3-7,10-11H,1-2H3 |
| InChIKey | BNZGFVVMZNPOGC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|