C12H12ClF5 — CID 63434521
1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylbenzene (PubChem CID 63434521) has the molecular formula C12H12ClF5 and a molecular weight of 286.67 g/mol. Its IUPAC name is 1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylbenzene.
| Compound Name | 1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 63434521 |
| Molecular Formula | C12H12ClF5 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(C(Cl)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12ClF5/c1-7(2)8-3-5-9(6-4-8)10(13)11(14,15)12(16,17)18/h3-7,10H,1-2H3 |
| InChIKey | WGCWXQMDDHXOGP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|